CAS 330794-35-9

tert-butyl [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]carbamate

Description:

Tert-butyl [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]carbamate is a chemical compound characterized by its complex structure, which includes a tert-butyl group, a benzyl moiety, and a carbamate functional group. The presence of the dioxaborolane ring contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of carbon-boron bonds. This compound is typically used in medicinal chemistry and materials science due to its ability to participate in various chemical reactions, including cross-coupling reactions. Its stability and solubility in organic solvents make it suitable for laboratory use. Additionally, the tert-butyl group enhances the lipophilicity of the molecule, which can influence its biological activity and interaction with other compounds. Overall, this compound exemplifies the versatility of boron-containing compounds in synthetic organic chemistry.

Formula: C₁₈H₂₈BNO₄

InChI: InChI=1/C18H28BNO4/c1-16(2,3)22-15(21)20-12-13-8-10-14(11-9-13)19-23-17(4,5)18(6,7)24-19/h8-11H,12H2,1-7H3,(H,20,21)

SMILES: CC(C)(C)OC(=NCc1ccc(cc1)B1OC(C)(C)C(C)(C)O1)O

4-((N-BOC-AMINO)METHYL)PHENYLBORONIC ACID PINACOL ESTER

CAS: 330794-35-9

Formula: C₁₈H₂₈BNO₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 333.2302

Ref: IN-DA00C0FZ

tert-Butyl N-{[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl}carbamate

CAS: 330794-35-9

tert-Butyl N-{[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl}carbamate

Purity: 97%

Color and Shape: Solid

Molecular weight: 333.23g/mol

Ref: 54-OR310853

4-(N-Boc-aminomethyl)phenylboronic acid pinacol ester

CAS: 330794-35-9

Purity: 98%

Molecular weight: 333.23

Ref: FT-A1255

tert-Butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzylcarbamate

CAS: 330794-35-9

Formula: C₁₈H₂₈BNO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 333.24

Ref: 10-F219836