CymitQuimica logo

CAS 330796-24-2

:

1-[4-chloro-3-(trifluoromethyl)phenyl]-3-{[3-(4-fluorophenyl)-4-oxo-3,4-dihydroquinazolin-2-yl]methyl}urea

Description:
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-{[3-(4-fluorophenyl)-4-oxo-3,4-dihydroquinazolin-2-yl]methyl}urea, with CAS number 330796-24-2, is a synthetic organic compound characterized by its complex structure, which includes a urea moiety and multiple aromatic rings. This compound features a chloro and trifluoromethyl substituent on one phenyl ring, contributing to its unique electronic properties and potential biological activity. The presence of a quinazolinone derivative suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its molecular structure indicates potential interactions with various biological targets, making it a candidate for further research in drug discovery. Additionally, the presence of fluorine atoms may enhance lipophilicity and metabolic stability, which are important factors in pharmacokinetics. Overall, this compound exemplifies the intricate design often found in modern medicinal chemistry, where modifications to aromatic systems can lead to significant changes in biological activity and therapeutic potential.
Formula:C23H15ClF4N4O2
InChI:InChI=1/C23H15ClF4N4O2/c24-18-10-7-14(11-17(18)23(26,27)28)30-22(34)29-12-20-31-19-4-2-1-3-16(19)21(33)32(20)15-8-5-13(25)6-9-15/h1-11H,12H2,(H2,29,30,34)
SMILES:c1ccc2c(c1)c(=O)n(c1ccc(cc1)F)c(CN=C(Nc1ccc(c(c1)C(F)(F)F)Cl)O)n2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.