CAS 3308-64-3
:1,2-Dihydro-3-methylbenz[j]aceanthrylen-2-ol
Description:
1,2-Dihydro-3-methylbenz[j]aceanthrylen-2-ol, with the CAS number 3308-64-3, is a polycyclic aromatic compound characterized by its complex fused ring structure. This compound features a hydroxyl (-OH) group, which contributes to its chemical reactivity and solubility properties. The presence of the methyl group enhances its hydrophobic characteristics, influencing its interactions in various chemical environments. Typically, compounds of this nature exhibit significant fluorescence properties, making them of interest in fields such as organic electronics and photonics. Additionally, due to the polycyclic nature of the structure, it may exhibit stability under certain conditions, but also potential reactivity with electrophiles or nucleophiles. The compound's unique structure may also impart specific biological activities, warranting investigation in medicinal chemistry. Overall, 1,2-Dihydro-3-methylbenz[j]aceanthrylen-2-ol represents a fascinating subject for research due to its structural complexity and potential applications in various scientific domains.
Formula:C21H16O
InChI:InChI=1S/C21H16O/c1-12-6-7-14-10-17-15-5-3-2-4-13(15)8-9-16(17)18-11-19(22)20(12)21(14)18/h2-10,19,22H,11H2,1H3
InChI key:InChIKey=VDFMUCPEGUQOGZ-UHFFFAOYSA-N
SMILES:OC1C=2C3=C(C=4C(C=C3C=CC2C)=C5C(=CC4)C=CC=C5)C1
Synonyms:- 1,2-Dihydro-3-methylbenz[j]aceanthrylen-2-ol
- 2-Cholanthrenol, 3-methyl-
- 2-Hydroxy-3-methylcholanthrene
- 3-Methylcholanthren-2-ol
- Benz[J]Aceanthrylen-2-Ol, 1,2-Dihydro-3-Methyl-
- 3-Methyl-1,2-dihydrocyclopenta[ij]tetraphen-2-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Hydroxy-3-methylcholanthrene
CAS:Controlled ProductFormula:C21H16OColor and Shape:NeatMolecular weight:284.3512-Hydroxy-3-methylcholanthrene
CAS:2-Hydroxy-3-methylcholanthrene is a medicinal analog that has been shown to have potent anticancer activity. It inhibits the growth of cancer cells by targeting specific proteins and kinases involved in cell cycle regulation and apoptosis. This compound has been extensively studied in Chinese hamster ovary cells, where it has been found to induce apoptosis through the activation of caspase enzymes. 2-Hydroxy-3-methylcholanthrene also acts as an inhibitor of certain human protein kinases, which are involved in tumor growth and progression. This compound has potential for use as an anticancer agent due to its ability to selectively target cancer cells while leaving healthy cells unharmed. Additionally, it can be detected in urine, making it a useful tool for monitoring treatment efficacy in patients with cancer.Formula:C21H16OPurity:Min. 95%Molecular weight:284.3 g/mol

