CAS 330804-03-0
:2-(Methylsulfonyl)phenylboronic acid
Description:
2-(Methylsulfonyl)phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains a methylsulfonyl substituent. This compound typically exhibits properties such as being a white to off-white solid at room temperature, with good solubility in polar organic solvents like methanol and dimethyl sulfoxide. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The methylsulfonyl group enhances the compound's solubility and may influence its reactivity and biological activity. Additionally, boronic acids are often utilized in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in the synthesis of complex organic molecules. Safety precautions should be observed when handling this compound, as with many organoboron compounds, due to potential toxicity and reactivity. Overall, 2-(Methylsulfonyl)phenylboronic acid is a valuable reagent in synthetic chemistry.
Formula:C7H9BO4S
InChI:InChI=1/C7H9BO4S/c1-13(11,12)7-4-2-3-6(5-7)8(9)10/h2-5,9-10H,1H3
SMILES:CS(=O)(=O)c1cccc(c1)B(O)O
Synonyms:- 2-(Methanesulfonyl)phenylboronic acid
- [3-(Methylsulfonyl)Phenyl]Boronic Acid
- 3-(Methanesulphonyl)phenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(Methylsulfonyl)benzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H9BO4SPurity:98%Molecular weight:200.022-Methylsulfonylphenylboronic acid
CAS:Formula:C7H9BO4SPurity:95%Color and Shape:SolidMolecular weight:200.02002-(Methylsulphonyl)benzeneboronic acid
CAS:2-(Methylsulphonyl)benzeneboronic acidFormula:C7H9BO4SPurity:97%Color and Shape: white solidMolecular weight:200.02g/mol2-(Methylsulfonyl)phenylboronic acid
CAS:Formula:C7H9BO4SPurity:97%Color and Shape:SolidMolecular weight:200.02




