CAS 33083-43-1

5-[(dimethylamino)methyl]-1,3,4-oxadiazole-2(3H)-thione

Description:

5-[(Dimethylamino)methyl]-1,3,4-oxadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms. The compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the ring structure. The dimethylamino group attached to the oxadiazole ring enhances its nucleophilicity and can influence its reactivity and solubility in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in agrochemicals, pharmaceuticals, or as a building block in organic synthesis. The presence of both nitrogen and sulfur atoms in the structure can also impart specific electronic properties, which may be relevant in the design of materials or catalysts. Overall, 5-[(dimethylamino)methyl]-1,3,4-oxadiazole-2(3H)-thione is a versatile compound with potential applications across various fields of chemistry.

Formula: C₅H₉N₃OS

InChI: InChI=1/C5H9N3OS/c1-8(2)3-4-6-7-5(10)9-4/h3H2,1-2H3,(H,7,10)

SMILES: CN(C)Cc1nnc(o1)S

Synonyms:

• 1,3,4-oxadiazole-2(3H)-thione, 5-[(dimethylamino)methyl]-

5-[(Dimethylamino)methyl]-1,3,4-oxadiazole-2-thiol

CAS: 33083-43-1

Versatile small molecule scaffold

Formula: C₅H₉N₃OS

Purity: Min. 95%

Molecular weight: 159.21 g/mol

Ref: 3D-IBA08343