CymitQuimica logo

CAS 330855-07-7

:

(5Z)-3-ethyl-5-[(5-iodofuran-2-yl)methylidene]-2-thioxo-1,3-thiazolidin-4-one

Description:
The chemical substance known as (5Z)-3-ethyl-5-[(5-iodofuran-2-yl)methylidene]-2-thioxo-1,3-thiazolidin-4-one, with the CAS number 330855-07-7, is a thiazolidinone derivative characterized by its unique structural features, including a thiazolidine ring and a furan moiety. This compound typically exhibits a thioxo group, which contributes to its reactivity and potential biological activity. The presence of the iodine atom in the furan ring may enhance its pharmacological properties, possibly influencing its interaction with biological targets. The ethyl group attached to the thiazolidinone core can affect the compound's lipophilicity and solubility, which are critical for its bioavailability. Such compounds are often investigated for their potential therapeutic applications, including antimicrobial and anticancer activities, due to their ability to interact with various biological pathways. Overall, the specific characteristics of this compound, including its molecular structure and functional groups, suggest a promising avenue for research in medicinal chemistry and drug development.
Formula:C10H8INO2S2
InChI:InChI=1/C10H8INO2S2/c1-2-12-9(13)7(16-10(12)15)5-6-3-4-8(11)14-6/h3-5H,2H2,1H3/b7-5-
SMILES:CCN1C(=O)/C(=C/c2ccc(I)o2)/SC1=S
Synonyms:
  • (5Z)-3-ethyl-5-[(5-iodo-2-furyl)methylene]-2-thioxo-1,3-thiazolidin-4-one
Found 1 products.