CAS 33089-15-5
:4-chloro-2-(methylsulfanyl)pyrimidine-5-carbonitrile
Description:
4-Chloro-2-(methylsulfanyl)pyrimidine-5-carbonitrile, with the CAS number 33089-15-5, is a heterocyclic organic compound featuring a pyrimidine ring substituted with a chlorine atom, a methylthio group, and a cyano group. This compound typically exhibits characteristics common to pyrimidine derivatives, such as being a solid at room temperature and possessing a relatively high melting point. The presence of the cyano group contributes to its polarity and potential reactivity, making it useful in various chemical syntheses. The methylsulfanyl group can influence the compound's solubility and reactivity, often enhancing its nucleophilicity. Additionally, the chlorine atom may impart specific electronic properties, affecting the compound's behavior in chemical reactions. Overall, 4-chloro-2-(methylsulfanyl)pyrimidine-5-carbonitrile is of interest in medicinal chemistry and agricultural applications, particularly as a potential building block for pharmaceuticals or agrochemicals due to its unique structural features.
Formula:C6H4ClN3S
InChI:InChI=1/C6H4ClN3S/c1-11-6-9-3-4(2-8)5(7)10-6/h3H,1H3
SMILES:CSc1ncc(C#N)c(Cl)n1
Synonyms:- 5-Pyrimidinecarbonitrile, 4-chloro-2-(methylthio)-
- 4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile
- 4-Chloro-2-(methylsulfanyl)pyrimidine-5-carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile
CAS:Formula:C6H4ClN3SPurity:95%Color and Shape:SolidMolecular weight:185.63414-Chloro-2-(methylsulphanyl)pyrimidine-5-carbonitrile
CAS:4-Chloro-2-(methylsulphanyl)pyrimidine-5-carbonitrileFormula:C6H4ClN3SPurity:98%Color and Shape: off-white crystalsMolecular weight:185.63g/mol4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile
CAS:4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile (MTPC) is a cardiac drug that has been shown to be effective in preventing autoimmune myocarditis and heart transplant rejection. It inhibits the activity of protein kinase, which is an enzyme involved in the development of autoimmune diseases. MTPC was found to be selective for rat heart isozymes and does not inhibit other isozymes, such as those found in brain, kidney, or liver tissues. MTPC also has high selectivity for allografts over autoantigens.
Formula:C6H4ClN3SPurity:Min. 95%Color and Shape:PowderMolecular weight:185.63 g/mol4-Chloro-2-(methylthio)pyrimidine-5-carbonitrile
CAS:Formula:C6H4ClN3SPurity:95%Color and Shape:Solid, Yellow powderMolecular weight:185.63



