CAS 330942-05-7: Betrixaban
Description:Betrixaban is an oral anticoagulant that belongs to the class of direct factor Xa inhibitors. It is primarily used for the prevention of venous thromboembolism in patients undergoing elective hip or knee replacement surgery. The substance works by selectively inhibiting factor Xa, an essential enzyme in the coagulation cascade, thereby reducing thrombin generation and preventing clot formation. Betrixaban is characterized by its high bioavailability and a relatively long half-life, allowing for once-daily dosing. Its chemical structure includes a unique bicyclic core that contributes to its potency and specificity for factor Xa. The pharmacokinetics of Betrixaban are influenced by factors such as age, renal function, and concomitant medications, which can affect its metabolism and clearance. As with other anticoagulants, monitoring for bleeding risks is crucial during its use. Overall, Betrixaban represents a significant advancement in anticoagulant therapy, providing an effective option for thromboprophylaxis with a favorable safety profile.
Formula:C23H22ClN5O3
InChI:InChI=1S/C23H22ClN5O3/c1-29(2)21(25)14-4-6-15(7-5-14)22(30)27-19-10-9-17(32-3)12-18(19)23(31)28-20-11-8-16(24)13-26-20/h4-13,25H,1-3H3,(H,27,30)(H,26,28,31)
InChI key:InChIKey=XHOLNRLADUSQLD-UHFFFAOYSA-N
SMILES:O=C(NC1=CC=C(OC)C=C1C(=O)NC2=NC=C(Cl)C=C2)C3=CC=C(C=C3)C(=N)N(C)C
- Synonyms:
- Benzamide, N-(5-chloro-2-pyridinyl)-2-[[4-[(dimethylamino)iminomethyl]benzoyl]amino]-5-methoxy-
- Betrixaban
- Bevyxxa
- N-(5-Chloro-2-pyridinyl)-2-[[4-[(dimethylamino)iminomethyl]benzoyl]amino]-5-methoxybenzamide
- Prt 054021
