
CAS 33098-21-4: 4,5-dichloro-2-(4-methylphenyl)-2,3-dihydropyridazin-3-one
Description:4,5-Dichloro-2-(4-methylphenyl)-2,3-dihydropyridazin-3-one is a chemical compound characterized by its unique structure, which includes a pyridazinone core with dichloro and methylphenyl substituents. This compound typically exhibits a solid state at room temperature and is often used in various chemical syntheses and research applications. The presence of chlorine atoms contributes to its reactivity, while the methylphenyl group can influence its solubility and interaction with biological systems. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point and solubility in different solvents. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4,5-dichloro-2-(4-methylphenyl)-2,3-dihydropyridazin-3-one is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C11H8Cl2N2O
InChI:InChI=1/C11H8Cl2N2O/c1-7-2-4-8(5-3-7)15-11(16)10(13)9(12)6-14-15/h2-6H,1H3
- Synonyms:
- 4,5-dichloro-2-(4-methylphenyl)pyridazin-3(2H)-one
- 4,5-Dichloro-2-(4-Methylphenyl)-2,3-Dihydropyridaz
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4,5-Dichloro-2-(4-methylphenyl)-2,3-dihydropyridazin-3-one REF: 3D-IBA09821CAS: 33098-21-4 | Min. 95% | - - - | Discontinued product |

4,5-Dichloro-2-(4-methylphenyl)-2,3-dihydropyridazin-3-one
Ref: 3D-IBA09821
500mg | Discontinued | Request information |