CAS 330985-26-7

1-(2-methylpropanoyl)piperidine-4-carboxylic acid

Description:

1-(2-Methylpropanoyl)piperidine-4-carboxylic acid, with the CAS number 330985-26-7, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and an acyl substituent derived from 2-methylpropanoic acid, contributing to its unique reactivity and potential applications. The presence of the piperidine moiety suggests that it may exhibit basic properties due to the nitrogen atom, which can participate in hydrogen bonding and influence solubility in various solvents. Additionally, the carboxylic acid group can engage in acid-base reactions, making it useful in organic synthesis and medicinal chemistry. The compound's structural features may also impart specific biological activities, making it of interest in pharmaceutical research. Overall, its characteristics, including molecular structure, functional groups, and potential reactivity, position it as a compound of interest in various chemical and biological applications.

Formula: C₁₀H₁₇NO₃

InChI: InChI=1/C10H17NO3/c1-7(2)9(12)11-5-3-8(4-6-11)10(13)14/h7-8H,3-6H2,1-2H3,(H,13,14)

SMILES: CC(C)C(=O)N1CCC(CC1)C(=O)O

Synonyms:

• 1-Isobutyrylpiperidine-4-carboxylic acid
• 4-Piperidinecarboxylic acid, 1-(2-methyl-1-oxopropyl)-

1-Isobutyrylpiperidine-4-carboxylic acid

CAS: 330985-26-7

Formula: C₁₀H₁₇NO₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 199.25

Ref: 10-F038969