CAS 331-61-3
:3-Fluoro-4-methoxybenzyl bromide
Description:
3-Fluoro-4-methoxybenzyl bromide, with the CAS number 331-61-3, is an organic compound characterized by the presence of a fluorine atom and a methoxy group attached to a benzyl structure. This compound features a bromine atom, which contributes to its reactivity, particularly in nucleophilic substitution reactions. The fluorine atom introduces unique electronic properties, enhancing the compound's potential as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The methoxy group, being an electron-donating substituent, can influence the compound's reactivity and solubility in various solvents. Typically, compounds like this are utilized in organic synthesis, particularly in the development of more complex molecules. Its physical properties, such as boiling point and solubility, can vary based on the specific conditions and the presence of other functional groups. Safety considerations should be taken into account when handling this compound, as it may pose health risks due to the presence of halogens and the potential for reactivity.
Formula:C8H8BrFO
InChI:InChI=1/C8H8BrFO/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4H,5H2,1H3
SMILES:COc1ccc(cc1F)CBr
Synonyms:- 331-61-3
- 4-(Bromomethyl)-2-fluoro-1-methoxybenzene
- 4-(Bromomethyl)-2-fluorophenyl methyl ether
- Benzene, 4-(bromomethyl)-2-fluoro-1-methoxy-
- E1R Cf Do1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Fluoro-4-methoxybenzyl bromide, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H8BrFOPurity:98%Color and Shape:Pale cream to cream, Crystals or powder or crystalline powderMolecular weight:219.05Benzene, 4-(bromomethyl)-2-fluoro-1-methoxy-
CAS:Formula:C8H8BrFOPurity:97%Color and Shape:SolidMolecular weight:219.05093-Fluoro-4-methoxybenzyl bromide
CAS:3-Fluoro-4-methoxybenzyl bromideFormula:C8H8BrFOPurity:97%Color and Shape: red solidMolecular weight:219.05g/mol3-Fluoro-4-methoxybenzyl bromide
CAS:Formula:C8H8BrFOPurity:97%Color and Shape:SolidMolecular weight:219.053



