CAS 3310-47-2
:(4E)-3-hydroxy-4-imino-1-pentofuranosyl-3,4-dihydropyrimidin-2(1H)-one
Description:
The chemical substance known as (4E)-3-hydroxy-4-imino-1-pentofuranosyl-3,4-dihydropyrimidin-2(1H)-one, with the CAS number 3310-47-2, is a compound that features a complex structure involving a furanosyl moiety and a dihydropyrimidinone core. This compound is characterized by its unique arrangement of functional groups, including a hydroxyl group and an imino group, which contribute to its reactivity and potential biological activity. The presence of the furanosyl ring suggests that it may have nucleoside-like properties, potentially influencing its interaction with biological systems. Additionally, the dihydropyrimidinone structure is known for its role in various biochemical processes, including its involvement in the synthesis of nucleic acids. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its stability, solubility, and reactivity can vary based on environmental conditions, which are important factors to consider in its application and study.
Formula:C9H13N3O6
InChI:InChI=1/C9H13N3O6/c10-5-1-2-11(9(16)12(5)17)8-7(15)6(14)4(3-13)18-8/h1-2,4,6-8,10,13-15,17H,3H2/b10-5+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
