CAS 33103-21-8
:3,6-diamino-N-[(6E)-3-(2-amino-6-hydroxy-3,4,5,6-tetrahydropyrimidin-4-yl)-6-[(carbamoylamino)methylidene]-9,12-bis(hydroxymethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentaazacyclohexadecan-15-yl]-4-hydroxyhexanamide (non-preferred name)
Description:
The chemical substance known as 3,6-diamino-N-[(6E)-3-(2-amino-6-hydroxy-3,4,5,6-tetrahydropyrimidin-4-yl)-6-[(carbamoylamino)methylidene]-9,12-bis(hydroxymethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentaazacyclohexadecan-15-yl]-4-hydroxyhexanamide, with the CAS number 33103-21-8, is a complex organic compound characterized by multiple functional groups and a unique structural framework. It features a pentaazacyclohexadecane core, which contributes to its potential biological activity and stability. The presence of amino, hydroxy, and carbamoyl groups suggests that this compound may exhibit significant solubility in polar solvents and could participate in various chemical reactions, including hydrogen bonding and coordination with metal ions. Its intricate structure indicates potential applications in medicinal chemistry, possibly as an antimicrobial or anticancer agent, due to the presence of the tetrahydropyrimidine moiety, which is often associated with biological activity. Overall, this compound's complexity and functional diversity make it a subject of interest for further research in pharmaceutical and biochemical fields.
Formula:C25H43N13O11
InChI:InChI=1/C25H43N13O11/c26-2-1-15(41)9(27)3-16(42)32-11-5-30-23(48)18(10-4-17(43)37-24(28)36-10)38-20(45)12(6-31-25(29)49)33-21(46)13(7-39)35-22(47)14(8-40)34-19(11)44/h6,9-11,13-15,17-18,39-41,43H,1-5,7-8,26-27H2,(H,30,48)(H,32,42)(H,33,46)(H,34,44)(H,35,47)(H,38,45)(H3,28,36,37)(H3,29,31,49)/b12-6+
Synonyms:- TUBERACTINOMYCIN A
- Tuberactinomycin A (8CI,9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tuberactinomycin A
CAS:<p>Tuberactinomycins are cyclic peptide antibiotics that effectively inhibit protein synthesis in prokaryotic organisms.</p>Formula:C25H43N13O11Color and Shape:SolidMolecular weight:701.69
