CAS 33119-63-0
:4,5-diphenyl-1,3-oxazol-2-amine
Description:
4,5-Diphenyl-1,3-oxazol-2-amine is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features two phenyl groups attached to the oxazole ring, contributing to its aromatic properties and potentially influencing its reactivity and solubility. The presence of an amino group (-NH2) at the 2-position of the oxazole ring enhances its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and material science. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many organic compounds, safety precautions should be taken when handling 4,5-diphenyl-1,3-oxazol-2-amine, as it may pose health risks or environmental hazards.
Formula:C15H12N2O
InChI:InChI=1/C15H12N2O/c16-15-17-13(11-7-3-1-4-8-11)14(18-15)12-9-5-2-6-10-12/h1-10H,(H2,16,17)
SMILES:c1ccc(cc1)c1c(c2ccccc2)oc(=N)[nH]1
Synonyms:- 2-Oxazolamine, 4,5-diphenyl-
- 4,5-Diphenyl-oxazol-2-ylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4,5-Diphenyl-oxazol-2-ylamine
CAS:<p>4,5-Diphenyl-oxazol-2-ylamine is a heterocycle that belongs to the pyridine class of heterocycles. It has been synthesized by a two step process starting with 2,6-dichloropyridine. The first step is a nucleophilic substitution reaction involving the chloro group and an amine group at C3 position of the pyridine ring. The second step involves an electrophilic aromatic substitution reaction with 4,5-diphenyloxazole to form the desired product. This compound has been shown to be more reactive than other heterocycles due to its electron withdrawing groups.</p>Formula:C15H12N2OPurity:Min. 95%Molecular weight:236.27 g/mol
