CymitQuimica logo

CAS 331281-25-5

:

tert-butyl 4-amino-4-cyanopiperidine-1-carboxylate

Description:
Tert-butyl 4-amino-4-cyanopiperidine-1-carboxylate is a chemical compound characterized by its piperidine structure, which includes a tert-butyl group and a cyano group attached to the piperidine ring. This compound features an amino group and a carboxylate functional group, contributing to its potential as a building block in organic synthesis and medicinal chemistry. The presence of the tert-butyl group enhances its lipophilicity, which can influence its biological activity and solubility properties. The cyano group introduces a polar functional group that can participate in various chemical reactions, such as nucleophilic additions or substitutions. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its CAS number, 331281-25-5, allows for easy identification and retrieval of information in chemical databases. Overall, tert-butyl 4-amino-4-cyanopiperidine-1-carboxylate is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H19N3O2
InChI:InChI=1/C11H19N3O2/c1-10(2,3)16-9(15)14-6-4-11(13,8-12)5-7-14/h4-7,13H2,1-3H3
InChI key:ZDAOYEIIJSEFSW-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)(C#N)N
Synonyms:
  • Tert-butyl 4-amino-4-cyanopiperidine-1-carboxylate
Found 5 products.