CAS 3313-38-0
:2-Benzoxazolecarboxamide
Description:
2-Benzoxazolecarboxamide, with the CAS number 3313-38-0, is an organic compound characterized by its benzoxazole ring structure, which is a fused bicyclic system containing both benzene and oxazole moieties. This compound typically exhibits properties such as being a white to off-white solid, and it is soluble in polar organic solvents. The presence of the carboxamide functional group contributes to its potential as a hydrogen bond donor and acceptor, influencing its reactivity and interactions with other molecules. 2-Benzoxazolecarboxamide is often studied for its biological activities, including potential antimicrobial and anticancer properties, making it of interest in medicinal chemistry. Additionally, its structural features may allow for various modifications, leading to derivatives with enhanced or altered properties. Overall, this compound serves as a valuable scaffold in the development of pharmaceuticals and other chemical applications.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c9-7(11)8-10-5-3-1-2-4-6(5)12-8/h1-4H,(H2,9,11)
InChI key:InChIKey=WHHYMBKESAOOSX-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=NC=2C(O1)=CC=CC2
Synonyms:- 1,3-Benzoxazole-2-carboxamide
- 2-Benzoxazolecarboxamide(7CI,8CI,9CI)
- 2-Benzoxazolecarboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Benzooxazole-2-carboxylic acid amide
CAS:<p>Benzooxazole-2-carboxylic acid amide is a potent inhibitor of epidermal growth factor receptor (EGFR) tyrosine kinase, with IC50 values in the low nanomolar range. It also inhibits the activation of EGFR by other growth factors, such as epidermal growth factor (EGF) and transforming growth factor alpha (TGFα). Benzooxazole-2-carboxylic acid amide has been shown to inhibit tumor cell proliferation in vitro and in vivo. The mechanism of action is not fully understood but may involve interference with repair mechanisms that are activated by DNA damage. The drug binds to the EGFR receptor and prevents its phosphorylation by other molecules, which would otherwise activate it.</p>Formula:C8H6N2O2Purity:Min. 95%Molecular weight:162.15 g/mol
