CAS 33130-04-0
:2,3,4-Trimethoxybenzenepropanoic acid
Description:
2,3,4-Trimethoxybenzenepropanoic acid, with the CAS number 33130-04-0, is an organic compound characterized by its aromatic structure and the presence of multiple methoxy groups. This compound features a benzene ring substituted with three methoxy (-OCH3) groups at the 2, 3, and 4 positions, along with a propanoic acid functional group. The presence of these methoxy groups enhances its solubility in organic solvents and may influence its reactivity and biological activity. The propanoic acid moiety contributes to its acidity and potential interactions in biochemical pathways. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves methods of organic synthesis that allow for the selective introduction of functional groups onto the aromatic ring. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature. Overall, 2,3,4-Trimethoxybenzenepropanoic acid represents a versatile structure in organic chemistry with potential applications in various fields.
Formula:C12H16O5
InChI:InChI=1S/C12H16O5/c1-15-9-6-4-8(5-7-10(13)14)11(16-2)12(9)17-3/h4,6H,5,7H2,1-3H3,(H,13,14)
InChI key:InChIKey=QOPNYPCVRBRZOP-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(OC)=CC=C1CCC(O)=O
Synonyms:- 2,3,4-Trimethoxybenzenepropanoic acid
- 2,3,4-Trimethoxyhydrocinnamic acid
- 3-(2,3,4-Trimethoxyphenyl)Propanoic Acid
- Ai3-38430
- Benzenepropanoic acid, 2,3,4-trimethoxy-
- 3-(2,3,4-Trimethoxyphenyl)propionic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(2,3,4-Trimethoxyphenyl)propanoic acid
CAS:Formula:C12H16O5Purity:%Color and Shape:SolidMolecular weight:240.25243-(2,3,4-Trimethoxyphenyl)propanoic acid
CAS:3-(2,3,4-Trimethoxyphenyl)propanoic acidPurity:98+%Molecular weight:240.25g/mol3-(2,3,4-trimethoxyphenyl)propanoic acid
CAS:3-(2,3,4-Trimethoxyphenyl)propanoic acid is a high quality chemical that is used as a reagent and as a useful intermediate in the production of fine chemicals. CAS No. 33130-04-0 is a versatile building block with many applications in the research and development of compounds for use as pharmaceuticals, agrochemicals, or other chemicals. 3-(2,3,4-Trimethoxyphenyl)propanoic acid can be used to synthesize new chemical substances with different properties than those of the starting material. This compound has been shown to have many uses in organic synthesis due to its versatility and reactivity.Formula:C12H16O5Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:240.25 g/mol



