CymitQuimica logo

CAS 33130-55-1

:

N-(6-amino-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-N-methylformamide

Description:
N-(6-amino-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-N-methylformamide, with CAS number 33130-55-1, is a chemical compound that features a tetrahydropyrimidine core, which is characterized by its cyclic structure containing nitrogen atoms. This compound exhibits properties typical of both amides and pyrimidine derivatives, including potential solubility in polar solvents due to the presence of the formamide functional group. The presence of amino and carbonyl groups suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the dimethyl substitution on the pyrimidine ring can affect its steric and electronic properties, potentially impacting its biological activity. Such compounds may be of interest in medicinal chemistry for their potential pharmacological applications, particularly in the development of therapeutic agents. Overall, the unique structural features of this compound contribute to its chemical behavior and potential utility in various chemical and biological contexts.
Formula:C8H12N4O3
InChI:InChI=1/C8H12N4O3/c1-10(4-13)5-6(9)11(2)8(15)12(3)7(5)14/h4H,9H2,1-3H3
SMILES:CN(C=O)c1c(N)n(C)c(=O)n(C)c1=O
Synonyms:
  • formamide, N-(6-amino-1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.