CAS 33143-28-1

2,2-dimethyl-6-nitro-2H-chromene

Description:

2,2-Dimethyl-6-nitro-2H-chromene is an organic compound belonging to the chromene family, characterized by its fused benzene and pyran rings. This compound features a nitro group at the 6-position and two methyl groups at the 2-position of the chromene structure, which contribute to its unique chemical properties. It typically appears as a yellow to orange solid and is known for its potential applications in organic synthesis and as a fluorescent probe due to its conjugated system. The presence of the nitro group enhances its reactivity, making it a useful intermediate in various chemical reactions. Additionally, the methyl substituents can influence the compound's solubility and stability. As with many nitro compounds, it may exhibit sensitivity to heat and shock, necessitating careful handling. Overall, 2,2-dimethyl-6-nitro-2H-chromene is of interest in both academic research and industrial applications, particularly in the fields of materials science and medicinal chemistry.

Formula: C₁₁H₁₁NO₃

InChI: InChI=1/C11H11NO3/c1-11(2)6-5-8-7-9(12(13)14)3-4-10(8)15-11/h3-7H,1-2H3

SMILES: CC1(C)C=Cc2cc(ccc2O1)N(=O)=O

6-Nitro-2,2-dimethylchromene

Controlled Product

CAS: 33143-28-1

Formula: C₁₁H₁₁NO₃

Color and Shape: Neat

Molecular weight: 205.21

Ref: TR-N493775