CAS 331443-00-6

5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,2,3-benzenetriol

Description:

5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,2,3-benzenetriol, also known by its CAS number 331443-00-6, is an organic compound characterized by its complex polyphenolic structure. This substance features multiple hydroxyl groups, which contribute to its potential antioxidant properties and reactivity. The presence of the ethenyl group indicates that it has unsaturation, which can influence its chemical behavior and interactions with other molecules. The compound's structure suggests it may exhibit significant biological activity, particularly in the context of medicinal chemistry, where polyphenols are often studied for their health benefits. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in practical applications. Additionally, the compound's ability to form hydrogen bonds due to its hydroxyl groups may enhance its interactions with biological targets, potentially leading to various pharmacological effects. Overall, 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,2,3-benzenetriol is a noteworthy compound in the realm of organic chemistry and biochemistry.

Formula: C₁₄H₁₂O₄

InChI: InChI=1S/C14H12O4/c15-11-5-3-9(4-6-11)1-2-10-7-12(16)14(18)13(17)8-10/h1-8,15-18H/b2-1+

InChI key: InChIKey=GRZOJEWQFCAKPF-OWOJBTEDSA-N

SMILES: C(=C/C1=CC=C(O)C=C1)\C2=CC(O)=C(O)C(O)=C2

Synonyms:

• 1,2,3-Benzenetriol, 5-[(1E)-2-(4-hydroxyphenyl)ethenyl]-
• 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,2,3-benzenetriol

4-Hydroxyresveratrol

CAS: 331443-00-6

Resveratrol is a polyphenolic compound that has been shown to have antioxidant and anti-inflammatory properties. This substance can also protect cells from oxidative damage, which is caused by reactive oxygen species (ROS). Resveratrol has been found to be particularly effective in the treatment of leukemia cells, as well as cancer cells. It has also been shown to inhibit the production of ROS, as well as the expression of genes involved in cell death pathways. Resveratrol may reduce the risk of cancer by inhibiting tumor necrosis factor-alpha (TNF-α) and nitric oxide synthase (iNOS).

Formula: C₁₄H₁₂O₄

Purity: Min. 95%

Molecular weight: 244.24 g/mol

Ref: 3D-FH178782

4-Hydroxyresveratrol

CAS: 331443-00-6

4-Hydroxyresveratrol (3,4,5,4'-Tetrahydroxystibene) is a resveratrol analog that variably induces the expression of pro-apoptotic genes such as p53 and Bax. It triggers apoptosis in SV40 virus-transformed WI38 cells (WI38VA), but not in WI38 cells. Additionally, 4-Hydroxyresveratrol significantly increases the expression of p53, GADD45, and Bax genes in WI38VA cells, while suppressing the expression of the bcl-2 gene.

Formula: C₁₄H₁₂O₄

Color and Shape: Solid

Molecular weight: 244.243

Ref: TM-T205676