CAS 331465-71-5
:2,8,9-tris(2-methylpropyl)-2,8,9-triaza-5-azonia-1-phosphabicyclo[3.3.3]undecane
Description:
2,8,9-Tris(2-methylpropyl)-2,8,9-triaza-5-azonia-1-phosphabicyclo[3.3.3]undecane is a complex organic compound characterized by its unique bicyclic structure, which incorporates both nitrogen and phosphorus atoms. The presence of three 2-methylpropyl groups contributes to its hydrophobic nature, enhancing its solubility in organic solvents. The triaza component indicates the presence of three nitrogen atoms within the bicyclic framework, which can influence its reactivity and potential applications in coordination chemistry. The azonia designation suggests that the compound contains positively charged nitrogen atoms, which may impart interesting electrochemical properties. This compound may exhibit biological activity or serve as a ligand in metal coordination complexes, making it of interest in fields such as medicinal chemistry or materials science. Its structural complexity and functional groups suggest potential utility in various chemical applications, including catalysis or as a building block for more complex molecular architectures. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C18H40N4P
InChI:InChI=1/C18H39N4P/c1-16(2)13-20-10-7-19-8-11-21(14-17(3)4)23(20)22(12-9-19)15-18(5)6/h16-18H,7-15H2,1-6H3/p+1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,8,9-Triisobutyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane
CAS:Formula:C18H39N4PPurity:97%Color and Shape:LiquidMolecular weight:342.50282,8,9-Triisobutyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane
CAS:2,8,9-Triisobutyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecanePurity:95%Molecular weight:342.51g/mol2,8,9-Tri-i-butyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane, 97%
CAS:<p>2,8,9-Tri-i-butyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane, 97%</p>Formula:C18H39N4PPurity:97%Color and Shape:cloudy yellow liq.Molecular weight:342.502,8,9-Triisobutyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane
CAS:Formula:C18H39N4PPurity:97%;RGColor and Shape:LiquidMolecular weight:342.5122,8,9-Triisobutyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane
CAS:2,8,9-Triisobutyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane is a synthetic compound that has been shown to have a protective effect against metabolic disorders and other syndromes caused by damaged lipids. This drug binds to the active site of the enzyme diacylglycerol acyltransferase (DGAT) and inhibits lipid synthesis in cells. The fluorine atom in this compound may also provide some protection against damage by free radicals. 2,8,9-Triisobutyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane is marketed under the trade name of Lipexal and is used as an adjunct therapy for patients with type II diabetes mellitus and dyslipidemia.Formula:C18H39N4PPurity:Min. 95%Molecular weight:342.5 g/mol




