CAS 3316-02-7: 8-Hydroxy-1,3,6-naphthalenetrisulfonic acid

Description:8-Hydroxy-1,3,6-naphthalenetrisulfonic acid, with the CAS number 3316-02-7, is an organic compound characterized by its naphthalene structure substituted with three sulfonic acid groups and a hydroxyl group. This compound is typically a solid at room temperature and is soluble in water due to the presence of the sulfonic acid groups, which enhance its polarity. It exhibits strong acidic properties, making it useful in various applications, including as a pH indicator and in dye chemistry. The presence of multiple sulfonic acid groups contributes to its high ionic character, which can facilitate interactions with other ionic species in solution. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing its reactivity and solubility. This compound is often utilized in analytical chemistry and as a reagent in organic synthesis, particularly in the development of dyes and pigments. Its stability under a range of conditions makes it a valuable substance in both research and industrial applications.

Formula:C₁₀H₈O₁₀S₃

InChI:InChI=1S/C10H8O10S3/c11-8-3-6(21(12,13)14)1-5-2-7(22(15,16)17)4-9(10(5)8)23(18,19)20/h1-4,11H,(H,12,13,14)(H,15,16,17)(H,18,19,20)

InChI key:InChIKey=KMXMLAGYNHELHA-UHFFFAOYSA-N

SMILES:O=S(=O)(O)C=1C=C(O)C=2C(C1)=CC(=CC2S(=O)(=O)O)S(=O)(=O)O

Synonyms:
8-Hydroxy-1,3,6-naphthalenetrisulfonic acid
1-Naphthol-3,6,8-trisulfonic acid
1-Hydroxy-3,6,8-naphthalenetrisulfonic acid
1,3,6-Naphthalenetrisulfonic acid, 8-hydroxy-
3,6,8-Trisulfo-1-naphthol

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Ζ-Stat REF: 54-BUP02320CAS: 3316-02-7	98%	1,084.00 €~3,768.00 €	Mon 21 Apr 25
Ζ-Stat REF: TM-T35407CAS: 3316-02-7	98.01%	117.00 €~2,783.00 €	Thu 24 Apr 25
Zeta-stat REF: 3D-DAA31602CAS: 3316-02-7	Min. 95%	To inquire	Thu 29 May 25