CAS 33162-17-3
:1H-Pyrido[4,3-b]indole, 2,3,4,4a,5,9b-hexahydro-2,8-dimethyl-, hydrochloride (1:2)
Description:
1H-Pyrido[4,3-b]indole, 2,3,4,4a,5,9b-hexahydro-2,8-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and indole moieties. This compound is typically a white to off-white solid, and its hydrochloride form indicates it is a salt, enhancing its solubility in water. The presence of multiple methyl groups contributes to its hydrophobic characteristics, while the hexahydro configuration suggests it is a saturated derivative, which may influence its biological activity and stability. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 33162-17-3, allows for precise identification in chemical databases. As with many organic compounds, it is important to handle it with care, following appropriate safety protocols due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, including its reactivity, potential applications, and safety profile.
Formula:C13H18N2·2ClH
InChI:InChI=1S/C13H18N2.2ClH/c1-9-3-4-12-10(7-9)11-8-15(2)6-5-13(11)14-12;;/h3-4,7,11,13-14H,5-6,8H2,1-2H3;2*1H
InChI key:InChIKey=XWLFAMANDIWUKH-UHFFFAOYSA-N
SMILES:CC=1C=C2C3C(NC2=CC1)CCN(C)C3.Cl
Synonyms:- 1H-Pyrido[4,3-b]indole, 2,3,4,4a,5,9b-hexahydro-2,8-dimethyl-, dihydrochloride
- 1H-Pyrido[4,3-b]indole, 2,3,4,4a,5,9b-hexahydro-2,8-dimethyl-, hydrochloride (1:2)
- 2,3,4,4a,5,9b-Hexahydro-2,8-dimethyl-1H-pyrido[4,3-b]indole dihydrochloride
- Carbidin
- Carbidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,8-Dimethyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole dihydrochloride
CAS:2,8-Dimethyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole dihydrochloridePurity:≥95%Color and Shape:SolidMolecular weight:275.22g/mol2,8-Dimethyl-2,3,4,4a,5,9b-hexahydro-1H-pyrido-[4,3-b]indole dihydrochloride
CAS:<p>Dimebon is a drug that is used to treat Parkinson's disease and other neurological diseases. It binds to the GABA-B receptor and inhibits the uptake of dopamine. Dimebon also has an inhibitory effect on various growth factors and receptors, which may be beneficial in treating infectious diseases. Dimebon is water-soluble and can be administered orally or by injection; it is not known if dimebon can cross the blood-brain barrier.</p>Formula:C13H20Cl2N2Purity:Min. 95%Molecular weight:275.22 g/molCarbidine dihydrochloride
CAS:<p>Carbidine, a gamma-carboline derivative, is an atypical antipsychotic that modulates dopamine release and tyrosine hydroxylase activity.</p>Formula:C13H20Cl2N2Purity:98.59%Color and Shape:SolidMolecular weight:275.217



