CAS 331646-98-1

8-bromo-1H-3,1-benzoxazine-2,4-dione

Description:

8-Bromo-1H-3,1-benzoxazine-2,4-dione is a chemical compound characterized by its unique structure, which includes a benzoxazine ring fused with two carbonyl groups. This compound features a bromine atom at the 8-position of the benzoxazine, which can influence its reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the bromine substituent can enhance its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the dione functional groups contribute to its potential as a dye or in polymer chemistry, where it may serve as a building block for more complex materials. The compound's reactivity and stability can be affected by environmental factors such as temperature and pH. Overall, 8-bromo-1H-3,1-benzoxazine-2,4-dione is of interest in synthetic organic chemistry and materials science due to its distinctive structural features and potential applications.

Formula: C₈H₄BrNO₃

InChI: InChI=1/C8H4BrNO3/c9-5-3-1-2-4-6(5)10-8(12)13-7(4)11/h1-3H,(H,10,12)

SMILES: c1cc2c(c(c1)Br)nc(O)oc2=O

Synonyms:

• 2H-3,1-Benzoxazine-2,4(1H)-dione, 8-bromo-
• 8-Bromo-2H-3,1-benzoxazine-2,4(1H)-dione
• 8-Bromoisatoic anhydride

8-Bromo-1H-benzo[d][1,3]oxazine-2,4-dione

CAS: 331646-98-1

Formula: C₈H₄BrNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 242.0263

Ref: IN-DA007H9Y

3-Bromoisatoic anhydride

CAS: 331646-98-1

3-Bromoisatoic anhydride

Formula: C₈H₄BrNO₃

Purity: ≥95%

Color and Shape: off white crystalline solid

Molecular weight: 242.03g/mol

Ref: 54-OR400020

3-Bromoisatoic anhydride

CAS: 331646-98-1

Formula: C₈H₄BrNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 242.028

Ref: 10-F040876