CAS 331647-05-3

8-bromo-2,4-dichloroquinazoline

Description:

8-Bromo-2,4-dichloroquinazoline is a synthetic organic compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. The presence of bromine and chlorine substituents at specific positions on the quinazoline ring significantly influences its chemical properties and reactivity. This compound typically exhibits moderate to high lipophilicity due to its halogen substituents, which can enhance its biological activity. It is often utilized in medicinal chemistry and research for its potential as a pharmacological agent, particularly in the development of targeted therapies. The compound's molecular structure allows for various interactions with biological targets, making it a subject of interest in studies related to cancer and other diseases. Additionally, its stability and solubility characteristics can vary depending on the solvent and environmental conditions. As with many halogenated compounds, safety precautions should be taken when handling 8-bromo-2,4-dichloroquinazoline due to potential toxicity and environmental impact.

Formula: C₈H₃BrCl₂N₂

InChI: InChI=1/C8H3BrCl2N2/c9-5-3-1-2-4-6(5)12-8(11)13-7(4)10/h1-3H

SMILES: c1cc2c(c(c1)Br)nc(Cl)nc2Cl

Synonyms:

• Quinazoline, 8-Bromo-2,4-Dichloro-
• 8-Bromo-2,4-dichloro-quinazoline

8-Bromo-2,4-dichloroquinazoline

CAS: 331647-05-3

Formula: C₈H₃BrCl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 277.9328

Ref: IN-DA00C8KS

8-bromo-2,4-dichloroquinazoline

CAS: 331647-05-3

8-bromo-2,4-dichloroquinazoline

Purity: 97%

Color and Shape: Solid

Molecular weight: 277.93g/mol

Ref: 54-OR400858

8-Bromo-2,4-dichloroquinazoline

CAS: 331647-05-3

Formula: C₈H₃BrCl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 277.93

Ref: 10-F077198