CymitQuimica logo

CAS 331652-58-5

:

3,5-dimethyl-1-(4-nitrophenyl)piperazine

Description:
3,5-Dimethyl-1-(4-nitrophenyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of two methyl groups at the 3 and 5 positions of the piperazine ring contributes to its hydrophobic character, while the 4-nitrophenyl substituent introduces a polar and electron-withdrawing nitro group, enhancing its reactivity and potential biological activity. This compound is typically used in medicinal chemistry and pharmacological research due to its structural features that may influence its interaction with biological targets. Its molecular structure suggests potential applications in the development of pharmaceuticals, particularly in areas related to neurochemistry or as a scaffold for drug design. The compound's solubility, stability, and reactivity can vary based on the solvent and conditions, making it important to consider these factors in experimental settings. Safety data should be reviewed to ensure proper handling, as compounds with nitro groups can exhibit specific hazards.
Formula:C12H17N3O2
InChI:InChI=1/C12H17N3O2/c1-9-7-14(8-10(2)13-9)11-3-5-12(6-4-11)15(16)17/h3-6,9-10,13H,7-8H2,1-2H3
InChI key:UBLZWKCJZSDBGQ-UHFFFAOYSA-N
SMILES:CC1CN(CC(C)N1)c1ccc(cc1)N(=O)=O
Synonyms:
  • 3,5-Dimethyl-1-(4-nitro-phenyl)-piperazine
  • Piperazine, 3,5-Dimethyl-1-(4-Nitrophenyl)-
Found 3 products.