CAS 33170-68-2

1,3-bis(4-bromophenyl)propane-1,3-dione

Description:

1,3-bis(4-bromophenyl)propane-1,3-dione, with the CAS number 33170-68-2, is an organic compound characterized by its diketone structure, featuring two bromophenyl groups attached to a propane backbone. This compound typically exhibits a yellow to orange color and is known for its potential applications in organic synthesis and as a building block in the development of various pharmaceuticals and agrochemicals. The presence of bromine atoms enhances its reactivity and can influence its electronic properties, making it useful in various chemical reactions, including electrophilic substitutions. Additionally, the compound may exhibit interesting photophysical properties, which can be exploited in materials science and dye applications. Its solubility is generally moderate in organic solvents, and it may show limited solubility in water. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts associated with brominated organic substances. Proper safety measures should be taken when working with this compound in laboratory settings.

Formula: C₁₅H₁₀Br₂O₂

InChI: InChI=1/C15H10Br2O2/c16-12-5-1-10(2-6-12)14(18)9-15(19)11-3-7-13(17)8-4-11/h1-8H,9H2

SMILES: c1cc(ccc1C(=O)CC(=O)c1ccc(cc1)Br)Br

Synonyms:

• 1,3-Bis(4-bromophenyl)-1,3-propanedione
• 1,3-Bis[p-bromophenyl]-1,3-propanedione
• 1,3-Di-(4-bromophenyl)-1,3-propanedione
• 1,3-Propanedione, 1,3-Bis(4-Bromophenyl)-

1,3-Bis(4-bromophenyl)propane-1,3-dione

CAS: 33170-68-2

1,3-Bis(4-bromophenyl)propane-1,3-dione

Purity: 97%

Molecular weight: 382.05g/mol

Ref: 54-OR1036251

1,3-bis(4-bromophenyl)propane-1,3-dione

CAS: 33170-68-2

Formula: C₁₅H₁₀Br₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 382.051

Ref: 10-F425965