CymitQuimica logo

CAS 331713-76-9

:

N-(2-chlorobenzyl)-3-oxobutanamide

Description:
N-(2-chlorobenzyl)-3-oxobutanamide is an organic compound characterized by its amide functional group, which is linked to a 3-oxobutanamide structure. The presence of a 2-chlorobenzyl group introduces a chlorine atom on the benzene ring, contributing to the compound's unique chemical properties, such as increased lipophilicity and potential biological activity. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its hydrophobic characteristics. The oxobutanamide moiety suggests that it may participate in various chemical reactions, including acylation and nucleophilic attacks, due to the presence of both carbonyl and amine functionalities. Its molecular structure may also influence its reactivity and interactions with biological targets, making it of interest in medicinal chemistry and drug development. Safety data and handling precautions should be considered, as with any chemical substance, particularly due to the presence of the chlorine atom, which can impart toxicity or reactivity under certain conditions.
Formula:C11H12ClNO2
InChI:InChI=1/C11H12ClNO2/c1-8(14)6-11(15)13-7-9-4-2-3-5-10(9)12/h2-5H,6-7H2,1H3,(H,13,15)
InChI key:JLHUNKNCNYKDIO-UHFFFAOYSA-N
SMILES:CC(=O)CC(=NCc1ccccc1Cl)O
Synonyms:
  • N-[(2-chlorophenyl)methyl]-3-oxobutanamide
Found 1 products.