CAS 331717-63-6
:1-ethyl-3-methyl-imidazol-3-ium isothiocyanate
Description:
1-Ethyl-3-methyl-imidazol-3-ium isothiocyanate is an ionic liquid characterized by its unique imidazolium cation structure, which contributes to its stability and solubility properties. This compound features an ethyl group and a methyl group attached to the imidazolium ring, enhancing its hydrophobic characteristics. The isothiocyanate anion provides distinct reactivity, making it useful in various chemical applications, including organic synthesis and as a potential solvent for reactions involving polar and non-polar compounds. Its ionic nature typically results in a low vapor pressure, making it an environmentally friendly alternative to traditional organic solvents. Additionally, this substance exhibits thermal stability and a wide liquid range, which are advantageous for various industrial processes. The presence of the isothiocyanate group also suggests potential biological activity, which could be explored in pharmaceutical applications. Overall, 1-ethyl-3-methyl-imidazol-3-ium isothiocyanate is a versatile compound with significant implications in both chemical and biological fields.
Formula:C7H11N3S
InChI:InChI=1/C6H11N2.CNS/c1-3-8-5-4-7(2)6-8;2-1-3/h4-6H,3H2,1-2H3;/q+1;-1
Synonyms:- 1-Ethyl-3-methylimidazolium thiocyanate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Ethyl-3-methylimidazolium Thiocyanate
CAS:Formula:C7H11N3SPurity:>98.0%(T)(HPLC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:169.251-Ethyl-3-methylimidazolium thiocyanate, 98%
CAS:<p>It is used as a pharmaceutical intermediate and also used as primary and secondary intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar pro</p>Formula:C7H11N3SPurity:98%Molecular weight:169.251-Ethyl-3-Methylimidazolium Thiocyanate
CAS:1-Ethyl-3-Methylimidazolium ThiocyanatePurity:98%Molecular weight:169.25g/mol



