CAS 33174-08-2

1-(2-methylpropyl)piperazine dihydrochloride

Description:

1-(2-Methylpropyl)piperazine dihydrochloride, with the CAS number 33174-08-2, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 2-methylpropyl group attached to one of the nitrogen atoms, contributing to its unique properties. It is typically encountered as a dihydrochloride salt, which enhances its solubility in water and other polar solvents. The presence of the piperazine structure suggests potential applications in pharmaceuticals, particularly as a building block for various drug molecules due to its ability to interact with biological targets. The compound may exhibit basic properties due to the nitrogen atoms, allowing it to form salts with acids. Its physical characteristics, such as melting point and solubility, can vary based on the specific form and purity. As with many piperazine derivatives, it may possess psychoactive properties, making it of interest in medicinal chemistry and research. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₈H₂₀Cl₂N₂

InChI: InChI=1/C8H18N2.2ClH/c1-8(2)7-10-5-3-9-4-6-10;;/h8-9H,3-7H2,1-2H3;2*1H

SMILES: CC(C)CN1CCNCC1.Cl.Cl

Synonyms:

• 1-Isobutylpiperazine dihydrochloride
• Piperazine, 1-(2-methylpropyl)-, hydrochloride (1:2)

1-Isobutyl-piperazine dihydrochloride

CAS: 33174-08-2

Formula: C₈H₂₀Cl₂N₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 215.16

Ref: 10-F019965

1-Isobutylpiperazine dihydrochloride

Controlled Product

CAS: 33174-08-2

Please enquire for more information about 1-Isobutylpiperazine dihydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₈H₂₀Cl₂N₂

Purity: Min. 95%

Molecular weight: 215.16 g/mol

Ref: 3D-FI155255