CAS 331763-76-9

(βR)-4-Bromo-β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid

Description:

(βR)-4-Bromo-β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid is a synthetic organic compound characterized by its complex structure, which includes a bromine atom, a fluorenylmethoxycarbonyl (Fmoc) protecting group, and a carboxylic acid functional group. This compound is typically used in peptide synthesis and as a building block in medicinal chemistry due to its ability to form stable amide bonds. The presence of the Fmoc group allows for selective protection of the amino group during synthesis, facilitating the formation of peptides with specific sequences. The bromine substituent can also enhance the compound's reactivity and influence its biological activity. Additionally, the compound's chirality, indicated by the (βR) designation, suggests that it may exhibit specific stereochemical properties that can affect its interaction with biological targets. Overall, this compound is significant in the field of organic synthesis and drug development, particularly in the design of peptide-based therapeutics.

Formula: C₂₅H₂₂BrNO₄

InChI: InChI=1S/C25H22BrNO4/c26-17-11-9-16(10-12-17)13-18(14-24(28)29)27-25(30)31-15-23-21-7-3-1-5-19(21)20-6-2-4-8-22(20)23/h1-12,18,23H,13-15H2,(H,27,30)(H,28,29)/t18-/m1/s1

InChI key: InChIKey=SZPFLELHTJMABC-GOSISDBHSA-N

SMILES: C(OC(N[C@H](CC1=CC=C(Br)C=C1)CC(O)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• (βR)-4-Bromo-β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid
• Benzenebutanoic acid, 4-bromo-β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (βR)-
• Fmoc-(R)-3-Amino-4-(4-Bromo-Phenyl)-Butyric Acid

FMOC-(R)-3-AMINO-4-(4-BROMO-PHENYL)-BUTYRIC ACID

CAS: 331763-76-9

Formula: C₂₅H₂₂BrNO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 480.3505

Ref: IN-DA00BYZ4

(R)-3-((((9H-Ffluoren-9-yl)methoxy)carbonyl)amino)-4-(4-bromophenyl)butanoic acid

CAS: 331763-76-9

(R)-3-((((9H-Ffluoren-9-yl)methoxy)carbonyl)amino)-4-(4-bromophenyl)butanoic acid

Purity: 98%

Molecular weight: 480.36g/mol

Ref: 54-OR1059379

Fmoc-(R)-3-Amino-4-(4-bromo-phenyl)-butyric acid

CAS: 331763-76-9

Purity: 98%

Molecular weight: 480.3580017

Ref: 10-F609686