CAS 331766-69-9
:1-(2-bromo-3-thienyl)-N-methyl-methanamine
Description:
1-(2-bromo-3-thienyl)-N-methyl-methanamine is a chemical compound characterized by its unique structure, which includes a thienyl group and a bromine atom. The presence of the thienyl ring, a five-membered aromatic heterocycle containing sulfur, contributes to its potential reactivity and biological activity. The N-methyl group indicates that the amine nitrogen is substituted with a methyl group, which can influence the compound's solubility and interaction with biological systems. The bromine atom introduces a halogen, which can enhance the compound's electrophilic properties and may play a role in its reactivity. This compound may be of interest in medicinal chemistry and materials science due to its structural features, which could lead to various applications, including as a precursor in organic synthesis or as a potential pharmacophore in drug development. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C6H8BrNS
InChI:InChI=1/C6H8BrNS/c1-8-4-5-2-3-9-6(5)7/h2-3,8H,4H2,1H3
SMILES:CNCc1ccsc1Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Bromo-3-[methyl(aminomethyl)]thiophene 97%
CAS:2-Bromo-3-[methyl(aminomethyl)]thiophene 97%Purity:97%N-Methyl-(2-bromothien-3-yl)methylamine
CAS:<p>N-Methyl-(2-bromothien-3-yl)methylamine (MTMA) is a monomer that can be polymerized to form polythiophenes. It is insoluble in water, but soluble in organic solvents such as chloroform and acetone. MTMA is used to produce polymers with the desirable properties of semiconductors, such as high electron mobility and high conductivity. Polythiophenes are synthesized by the reaction of MTMA with an oxidant, such as potassium persulfate or hydrogen peroxide. This process is catalyzed by metal ions such as iron or copper.</p>Formula:C6H8BrNSPurity:Min. 95%Molecular weight:206.11 g/mol

