CAS 3318-61-4

1-Phenyl-2,4-pentanedione

Description:

1-Phenyl-2,4-pentanedione, also known as acetylacetone phenyl derivative, is an organic compound characterized by its diketone structure, featuring two carbonyl (C=O) groups flanked by a phenyl group and a pentanedione backbone. This compound typically appears as a yellow to amber liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol, acetone, and chloroform, but has limited solubility in water due to its hydrophobic phenyl group. The presence of the diketone functional groups allows for chelation with metal ions, making it useful in coordination chemistry and as a ligand in various applications. Additionally, 1-Phenyl-2,4-pentanedione exhibits potential biological activity, including antimicrobial and antioxidant properties. Its reactivity can be attributed to the enolization of the diketone, which can participate in various chemical reactions, including condensation and polymerization. Overall, this compound is of interest in both synthetic organic chemistry and materials science due to its versatile chemical behavior.

Formula: C₁₁H₁₂O₂

InChI: InChI=1/C11H12O2/c1-9(12)7-11(13)8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3

InChI key: InChIKey=NROOHYGFTHTDFF-UHFFFAOYSA-N

SMILES: C(C(CC(C)=O)=O)C1=CC=CC=C1

Synonyms:

• (Phenylacetyl)acetone
• 1-Benzyl-1,3-butanedione
• 1-Phenyl-2,4-pentanedione
• 2,4-Pentanedione, 1-phenyl-
• 1-Phenylpentane-2,4-dione

1-Phenylpentane-2,4-dione, 98%

CAS: 3318-61-4

Formula: C11H12O2

Color and Shape: Light-yellow to yellow liquid

Molecular weight: 176.21

Ref: BD-BD60136

1-Phenyl-2,4-pentanedione

CAS: 3318-61-4

Formula: C₁₁H₁₂O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 176.2118

Ref: IN-DA00CAC9

1-Phenylpentane-2,4-dione

CAS: 3318-61-4

Formula: C₁₁H₁₂O₂

Purity: 95%

Molecular weight: 176.215

Ref: 10-F234263

1-Phenylpentane-2,4-dione

CAS: 3318-61-4

1-Phenylpentane-2,4-dione is a molecule that absorbs light. It has been shown to be an efficient absorber of solar radiation and has the potential to be used in photovoltaic devices. 1-Phenylpentane-2,4-dione can be used as an electron donor in polymer solar cells because it is able to act as both a chelate and a light absorber. 1-Phenylpentane-2,4-dione can also be used in acetone peroxide based solar cells because it is able to absorb light efficiently. In addition, 1-phenylpentane-2,4-dione may have use as an optical element for positioning systems such as telescopes or cameras.

Formula: C₁₁H₁₂O₂

Purity: Min. 95%

Molecular weight: 176.21 g/mol

Ref: 3D-DAA31861