CAS 331834-13-0

1-benzofuran-5-ylboronic acid

Description:

1-Benzofuran-5-ylboronic acid is an organic compound characterized by the presence of a benzofuran moiety and a boronic acid functional group. The benzofuran structure consists of a fused benzene and furan ring, contributing to its aromatic properties and potential for π-π interactions. The boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which is a characteristic feature of boronic acids. Its reactivity allows it to participate in cross-coupling reactions, particularly in the formation of carbon-carbon bonds, which is essential in the synthesis of complex organic molecules. Additionally, the presence of the boronic acid group makes it a candidate for use in drug development and as a building block in the synthesis of biologically active compounds.

Formula: C₈H₇BO₃

InChI: InChI=1/C8H7BO3/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5,10-11H

SMILES: c1cc2c(cco2)cc1B(O)O

Synonyms:

• boronic acid, B-5-benzofuranyl-
• Benzofuran-5-Boronicacid

Benzo[b]furan-5-boronic acid

CAS: 331834-13-0

Formula: C₈H₇BO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.9504

Ref: IN-DA00BYS0

Benzo[b]furan-5-boronic acid

CAS: 331834-13-0

Benzo[b]furan-5-boronic acid

Formula: C₈H₇BO₃

Purity: ≥95%

Color and Shape: white to off-white solid

Molecular weight: 161.95g/mol

Ref: 54-OR7149

Benzofuran-5-ylboronic acid

CAS: 331834-13-0

Formula: C₈H₇BO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.95

Ref: 10-F219837