CymitQuimica logo

CAS 331942-46-2

:

3-[(Phenylamino)methyl]benzoic acid

Description:
3-[(Phenylamino)methyl]benzoic acid, identified by its CAS number 331942-46-2, is an organic compound characterized by its structure, which features a benzoic acid moiety substituted with a phenylamino group at the 3-position. This compound typically exhibits properties associated with both aromatic amines and carboxylic acids, including potential solubility in polar solvents and moderate to low solubility in non-polar solvents. The presence of the carboxylic acid functional group suggests acidic behavior, allowing it to participate in acid-base reactions. Additionally, the phenylamino group can influence the compound's reactivity and interactions, potentially enhancing its ability to form hydrogen bonds. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various applications in organic synthesis and medicinal chemistry, where modifications can lead to derivatives with enhanced properties. Safety and handling considerations should be observed due to the potential toxicity associated with aromatic amines.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c16-14(17)12-6-4-5-11(9-12)10-15-13-7-2-1-3-8-13/h1-9,15H,10H2,(H,16,17)
InChI key:InChIKey=OYVGWXUICDQOKV-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)C2=CC(C(O)=O)=CC=C2
Synonyms:
  • Benzoic acid, 3-[(phenylamino)methyl]-
  • 3-[(Phenylamino)methyl]benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • DHFR-IN-2

    CAS:
    DHFR-IN-2 (4e) is a potent MtDHFR uncompetitive inhibitor with a 7 μM IC50, promising for TB research.
    Formula:C14H13NO2
    Color and Shape:Solid
    Molecular weight:227.26