CAS 332-26-3
:4-(trifluoromethylthio)benzonitrile
Description:
4-(Trifluoromethylthio)benzonitrile, with the CAS number 332-26-3, is an organic compound characterized by the presence of a benzonitrile moiety substituted with a trifluoromethylthio group at the para position. This compound typically appears as a solid and is known for its distinctive chemical properties due to the presence of both the nitrile (–C≡N) and trifluoromethylthio (–SCF3) functional groups. The trifluoromethylthio group imparts significant electronegativity and lipophilicity, influencing the compound's reactivity and solubility in various solvents. It is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in nucleophilic substitution reactions. Additionally, the compound may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. Safety data should be consulted, as compounds with trifluoromethyl groups can exhibit toxicity and environmental persistence.
Formula:C8H8BrF
InChI:InChI=1/C8H8BrF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2
SMILES:c1cc(ccc1CCBr)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-[(Trifluoromethyl)thio]benzonitrile
CAS:4-[(Trifluoromethyl)thio]benzonitrilePurity:98%Color and Shape:SolidMolecular weight:203.18g/mol4-(Trifluoromethylthio)benzonitrile
CAS:4-(Trifluoromethylthio)benzonitrile is a chemical that is used as a scaffold in the synthesis of other chemicals. It can be used as a building block for complex compounds and as a starting material for research chemicals. This chemical has been reported to have high purity and quality, and it has been found to be useful as an intermediate. 4-(Trifluoromethylthio)benzonitrile is also versatile and can be used as an intermediate for organic synthesis or as a reagent in chemical reactions. It has CAS number 332-26-3.
Formula:C8H4F3NSPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:203.19 g/mol

