CAS 332099-33-9

3-Chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

Description:

3-Chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a thieno and pyrrole moiety. This compound features a chlorine substituent at the 3-position and a carboxylic acid functional group at the 5-position, which contributes to its acidic properties. The presence of the thieno ring enhances its electronic properties, making it potentially useful in various applications, including organic electronics and pharmaceuticals. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its reactivity can be influenced by the electron-withdrawing nature of the chlorine atom and the acidic hydrogen of the carboxylic group, allowing for potential derivatization reactions. As with many heterocycles, it may also display interesting biological activities, warranting further investigation in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₄ClNO₂S

InChI: InChI=1S/C7H4ClNO2S/c8-3-2-12-5-1-4(7(10)11)9-6(3)5/h1-2,9H,(H,10,11)

InChI key: InChIKey=FDGNVONVURZBLL-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C=C(C(O)=O)N2)SC1

Synonyms:

• 3-Chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
• 5-Carboxy-3-chloro-4H-thieno[3,2-b]pyrrole
• 4H-Thieno[3,2-b]pyrrole-5-carboxylic acid, 3-chloro-

3-Chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

CAS: 332099-33-9

Versatile small molecule scaffold

Formula: C₇H₄ClNO₂S

Purity: Min. 95%

Molecular weight: 201.63 g/mol

Ref: 3D-HNA09933