CymitQuimica logo

CAS 332099-36-2

:

3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

Description:
3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both thieno and pyrrole moieties. The presence of a bromine atom at the 3-position enhances its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound features a carboxylic acid functional group, which contributes to its acidity and solubility in polar solvents. The thieno and pyrrole rings provide a conjugated system that can exhibit interesting electronic properties, making it a candidate for use in organic electronics and dye-sensitized solar cells. Additionally, the compound's structural features may impart biological activity, warranting investigation for potential pharmaceutical applications. Its CAS number, 332099-36-2, allows for easy identification and retrieval of information in chemical databases. Overall, 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C7H4BrNO2S
InChI:InChI=1S/C7H4BrNO2S/c8-3-2-12-5-1-4(7(10)11)9-6(3)5/h1-2,9H,(H,10,11)
InChI key:InChIKey=WQGQGYADKDKACG-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=C(C(O)=O)N2)SC1
Synonyms:
  • 4H-Thieno[3,2-b]pyrrole-5-carboxylic acid, 3-bromo-
  • 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
Found 3 products.