CAS 332102-09-7

4-[(4-Phenyl-2-quinazolinyl)amino]benzoic acid

Description:

4-[(4-Phenyl-2-quinazolinyl)amino]benzoic acid, identified by its CAS number 332102-09-7, is a chemical compound characterized by its complex structure, which includes a quinazoline moiety and an amino group attached to a benzoic acid framework. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in medicinal chemistry due to its structural features that may interact with biological targets. The presence of the quinazoline ring suggests potential pharmacological activity, as quinazolines are known for their roles in various therapeutic areas, including anti-cancer and anti-inflammatory activities. The carboxylic acid group in the benzoic acid portion may contribute to its solubility in polar solvents and influence its reactivity. Additionally, the phenyl group can enhance lipophilicity, potentially affecting the compound's bioavailability. Overall, this compound's unique structural characteristics make it a subject of interest for further research in drug development and chemical synthesis.

Formula: C₂₁H₁₅N₃O₂

InChI: InChI=1S/C21H15N3O2/c25-20(26)15-10-12-16(13-11-15)22-21-23-18-9-5-4-8-17(18)19(24-21)14-6-2-1-3-7-14/h1-13H,(H,25,26)(H,22,23,24)

InChI key: InChIKey=WWZYTCHSHCEEGJ-UHFFFAOYSA-N

SMILES: N(C=1N=C(C2=C(N1)C=CC=C2)C3=CC=CC=C3)C4=CC=C(C(O)=O)C=C4

Synonyms:

• Benzoic acid, 4-[(4-phenyl-2-quinazolinyl)amino]-
• 4-[(4-Phenylquinazolin-2-yl)amino]benzoic acid
• 4-[(4-Phenyl-2-quinazolinyl)amino]benzoic acid

4-[(4-PHENYLQUINAZOLIN-2-YL)AMINO]BENZOIC ACID

CAS: 332102-09-7

Purity: 95.0%

Molecular weight: 341.3699951171875

Ref: 10-F531237