CAS 332103-27-2

1-(3-fluorophenyl)-3-(2-hydroxy-4-methylphenyl)propane-1,3-dione

Description:

1-(3-fluorophenyl)-3-(2-hydroxy-4-methylphenyl)propane-1,3-dione, with the CAS number 332103-27-2, is an organic compound characterized by its unique structure that includes a fluorinated phenyl group and a hydroxyl-substituted methylphenyl moiety. This compound features a diketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the fluorine atom enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The hydroxyl group can participate in hydrogen bonding, affecting the compound's solubility and interaction with biological targets. Additionally, the compound's structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its stability, reactivity, and specific interactions would depend on the surrounding conditions, such as pH and solvent, making it a versatile compound for further research and development in various fields of chemistry.

Formula: C₁₆H₁₃FO₃

InChI: InChI=1/C16H13FO3/c1-10-5-6-13(15(19)7-10)16(20)9-14(18)11-3-2-4-12(17)8-11/h2-8,19H,9H2,1H3

SMILES: Cc1ccc(c(c1)O)C(=O)CC(=O)c1cccc(c1)F

Synonyms:

• 1-(3-Fluoro-phenyl)-3-(2-hydroxy-4-methyl-phenyl)-propane-1,3-dione

1-(3-fluorophenyl)-3-(2-hydroxy-4-methylphenyl)propane-1,3-dione

CAS: 332103-27-2

Formula: C₁₆H₁₃FO₃

Purity: 95.0%

Molecular weight: 272.275

Ref: 10-F314568