CAS 332104-54-8

(5-bromo-2-hydroxyphenyl)(2-chlorophenyl)methanone

Description:

(5-bromo-2-hydroxyphenyl)(2-chlorophenyl)methanone, with the CAS number 332104-54-8, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with both bromine and hydroxyl groups, as well as a chlorophenyl moiety. This compound typically exhibits properties associated with aromatic ketones, such as stability and reactivity under certain conditions. The presence of halogen substituents (bromine and chlorine) can influence its chemical behavior, including its reactivity in electrophilic aromatic substitution reactions and its potential as a ligand in coordination chemistry. Additionally, the hydroxyl group contributes to its potential for hydrogen bonding, which may affect its solubility in various solvents and its interaction with biological systems. Overall, this compound may have applications in pharmaceuticals or materials science, depending on its specific reactivity and properties. Further studies would be necessary to fully elucidate its behavior in different chemical environments.

Formula: C₁₃H₈BrClO₂

InChI: InChI=1/C13H8BrClO2/c14-8-5-6-12(16)10(7-8)13(17)9-3-1-2-4-11(9)15/h1-7,16H

SMILES: c1ccc(c(c1)C(=O)c1cc(ccc1O)Br)Cl

(5-Bromo-2-hydroxyphenyl)(2-chlorophenyl)methanone

CAS: 332104-54-8

Formula: C₁₃H₈BrClO₂

Color and Shape: Solid

Molecular weight: 311.5584

Ref: IN-DA003MGM

5-Bromo-2'-chloro-2-hydroxybenzophenone

CAS: 332104-54-8

5-Bromo-2'-chloro-2-hydroxybenzophenone

Formula: C₁₃H₈BrClO₂

Purity: ≥95%

Color and Shape: faint yellow/green crystalline powder

Molecular weight: 311.56g/mol

Ref: 54-OR1128