CAS 332114-18-8
:2-[(5-Amino-1,3,4-thiadiazol-2-yl)thio]-N-(4-methoxyphenyl)acetamide
Description:
2-[(5-Amino-1,3,4-thiadiazol-2-yl)thio]-N-(4-methoxyphenyl)acetamide, with the CAS number 332114-18-8, is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and an acetamide functional group. The presence of the amino group on the thiadiazole contributes to its potential biological activity, making it of interest in pharmaceutical research. The methoxyphenyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. This compound may exhibit various properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Additionally, its synthesis involves standard organic chemistry techniques, including the formation of thioether linkages and acetamide functionalities. As with many compounds containing nitrogen and sulfur, it may also exhibit interesting coordination chemistry with metal ions. Overall, this compound represents a class of heterocyclic compounds that are valuable in medicinal chemistry and drug development.
Formula:C11H12N4O2S2
InChI:InChI=1S/C11H12N4O2S2/c1-17-8-4-2-7(3-5-8)13-9(16)6-18-11-15-14-10(12)19-11/h2-5H,6H2,1H3,(H2,12,14)(H,13,16)
InChI key:InChIKey=YKMXYAUVBJPIHD-UHFFFAOYSA-N
SMILES:N(C(CSC=1SC(N)=NN1)=O)C2=CC=C(OC)C=C2
Synonyms:- 2-[(5-Amino-1,3,4-thiadiazol-2-yl)thio]-N-(4-methoxyphenyl)acetamide
- 2-(5-Amino-[1,3,4]thiadiazol-2-ylsulfanyl)-N-(4-methoxy-phenyl)-acetamide
- 2-[(5-Amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide
- Acetamide, 2-[(5-amino-1,3,4-thiadiazol-2-yl)thio]-N-(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.