
CAS 332126-96-2
:1,2-Dihydro-4-(4-methylphenyl)-6-phenyl-2-thioxo-3-pyridinecarbonitrile
Description:
1,2-Dihydro-4-(4-methylphenyl)-6-phenyl-2-thioxo-3-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring, a thioxo group, and multiple aromatic substituents. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential biological activity and varied solubility depending on the solvent used. The presence of the thioxo group may impart unique reactivity, making it of interest in synthetic organic chemistry and medicinal chemistry. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored for pharmacological applications. Its CAS number, 332126-96-2, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound represents a class of organic molecules that may exhibit interesting chemical behavior and biological activity, warranting further investigation in various scientific fields.
Formula:C19H14N2S
InChI:InChI=1S/C19H14N2S/c1-13-7-9-14(10-8-13)16-11-18(15-5-3-2-4-6-15)21-19(22)17(16)12-20/h2-11H,1H3,(H,21,22)
InChI key:InChIKey=JHAQXWFIUAKEPS-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=C(NC1=S)C2=CC=CC=C2)C3=CC=C(C)C=C3
Synonyms:- 1,2-Dihydro-4-(4-methylphenyl)-6-phenyl-2-thioxo-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 1,2-dihydro-4-(4-methylphenyl)-6-phenyl-2-thioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.