CymitQuimica logo

CAS 332134-60-8

:

4-(6-bromopyridin-2-yl)morpholine

Description:
4-(6-Bromopyridin-2-yl)morpholine is a chemical compound characterized by its unique structure, which includes a morpholine ring and a brominated pyridine moiety. The presence of the bromine atom at the 6-position of the pyridine ring enhances its reactivity and can influence its biological activity. This compound typically exhibits properties such as moderate solubility in polar solvents due to the morpholine group, which can engage in hydrogen bonding. It may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which can be explored in drug development. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine substituent, making it a valuable candidate for further research in various chemical and pharmaceutical applications. Overall, 4-(6-bromopyridin-2-yl)morpholine represents a versatile scaffold for the synthesis of more complex molecules in the field of organic chemistry.
Formula:C9H11BrN2O
InChI:InChI=1/C9H11BrN2O/c10-8-2-1-3-9(11-8)12-4-6-13-7-5-12/h1-3H,4-7H2
InChI key:RCGFRLCJCFDVOQ-UHFFFAOYSA-N
SMILES:c1cc(Br)nc(c1)N1CCOCC1
Synonyms:
  • 2-Bromo-6-morpholinopyridine
  • 4-(6-Bromopyrid-2-Yl)Morpholine
  • Morpholine, 4-(6-bromo-2-pyridinyl)-
  • 4-(6-Bromopyridin-2-yl)morpholine
Found 4 products.