CAS 3322-70-1

2,2,5,5-Tetrakis(hydroxymethyl) cyclopentanone

Description:

2,2,5,5-Tetrakis(hydroxymethyl)cyclopentanone, with the CAS number 3322-70-1, is a cyclic ketone characterized by the presence of four hydroxymethyl groups attached to a cyclopentanone ring. This compound is typically a white to off-white solid at room temperature and is soluble in water and various organic solvents due to its multiple hydroxymethyl groups, which enhance its hydrophilicity. The presence of these functional groups also contributes to its reactivity, making it a versatile intermediate in organic synthesis and polymer chemistry. It can participate in various chemical reactions, including condensation and polymerization, and is often used in the production of resins and adhesives. Additionally, its structure allows for potential applications in the development of bio-based materials and pharmaceuticals. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate personal protective equipment to avoid skin and eye contact.

Formula: C₉H₁₆O₅

InChI: InChI=1/C9H16O5/c10-3-8(4-11)1-2-9(5-12,6-13)7(8)14/h10-13H,1-6H2

SMILES: C1CC(CO)(CO)C(=O)C1(CO)CO

Cyclopentanone,2,2,5,5-tetrakis(hydroxymethyl)-

CAS: 3322-70-1

Formula: C₉H₁₆O₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 204.2203

Ref: IN-DA0037DB

2,2,5,5-Tetrakis(hydroxymethyl)cyclopentan-1-one

CAS: 3322-70-1

Purity: 95%

Molecular weight: 204.2220001

Ref: 10-F772972