CAS 33225-74-0
:2-Nitro-4-pyridinecarboxylic acid
Description:
2-Nitro-4-pyridinecarboxylic acid, with the CAS number 33225-74-0, is an organic compound characterized by its pyridine ring substituted with both a nitro group and a carboxylic acid group. This compound typically appears as a yellow crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group. The nitro group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its acidic nature is attributed to the carboxylic acid moiety, which can donate protons in solution. This compound is of interest in synthetic organic chemistry and may be utilized in the development of pharmaceuticals or agrochemicals. Additionally, the presence of both electron-withdrawing (nitro) and electron-donating (pyridine) groups can influence its electronic properties, making it a subject of study in materials science and coordination chemistry. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.
Formula:C6H4N2O4
InChI:InChI=1S/C6H4N2O4/c9-6(10)4-1-2-7-5(3-4)8(11)12/h1-3H,(H,9,10)
InChI key:InChIKey=SXERXZLYZFAKBX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(N(=O)=O)N=CC1
Synonyms:- 2-Nitro-4-pyridinecarboxylic acid
- 2-Nitroisonicotinic acid
- 4-Pyridinecarboxylic acid, 2-nitro-
- Isonicotinic acid, 2-nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Nitropyridine-4-carboxylic acid, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H4N2O4Purity:95%Color and Shape:White to pale cream, PowderMolecular weight:168.112-Nitropyridine-4-carboxylic acid
CAS:Formula:C6H4N2O4Purity:98%Color and Shape:SolidMolecular weight:168.10702-Nitroisonicotinic acid
CAS:<p>2-Nitroisonicotinic acid</p>Formula:C6H4N2O4Purity:≥95%Color and Shape: white powderMolecular weight:168.11g/mol



