CAS 33234-36-5

2-chloro-3-methoxybenzoic acid

Description:

2-Chloro-3-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a chloro group and a methoxy group on a benzoic acid framework. The chloro group is located at the second position, while the methoxy group is at the third position relative to the carboxylic acid functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and amidation. The presence of the chloro and methoxy substituents can influence its reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, its molecular structure allows for potential applications in synthesis and as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₇ClO₃

InChI: InChI=1/C8H7ClO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,1H3,(H,10,11)

SMILES: COc1cccc(c1Cl)C(=O)O

Synonyms:

• oro-3-methoxybenzoic acid
• BENZOICACID,2-CHLORO-3-METHOXY
• 2-CHLORO-3-METHOXYBENZOIC ACID 97
• 2-Chloro-3-Methoxybenzoic acid 97%

2-Chloro-3-Methoxybenzoic Acid

CAS: 33234-36-5

Formula: C₈H₇ClO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 186.5924

Ref: IN-DA003GVS

2-Chloro-3-methoxybenzoic acid

CAS: 33234-36-5

2-Chloro-3-methoxybenzoic acid

Purity: 98%

Molecular weight: 186.59g/mol

Ref: 54-OR930912

2-Chloro-3-methoxybenzoic acid

CAS: 33234-36-5

Formula: C₈H₇ClO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 186.59

Ref: 10-F222058