CAS 332360-05-1
:(1R,2R)-1,2-dihydroxyethane-1,2-disulfonate
Description:
(1R,2R)-1,2-dihydroxyethane-1,2-disulfonate, also known as a sulfonated derivative of a diol, is characterized by the presence of two hydroxyl groups and two sulfonate groups attached to a two-carbon ethane backbone. This compound is typically a white crystalline solid, highly soluble in water due to the ionic nature of the sulfonate groups, which enhances its hydrophilicity. The presence of hydroxyl groups contributes to its potential as a chelating agent, allowing it to interact with metal ions. Its stereochemistry, indicated by the (1R,2R) configuration, suggests specific spatial arrangements that can influence its reactivity and interactions with biological systems. This compound may find applications in various fields, including pharmaceuticals, where it could serve as an intermediate or a functional agent in drug formulation. Additionally, its sulfonate groups may impart properties that are useful in surfactant applications or as a stabilizing agent in colloidal systems. Overall, its unique structure and functional groups make it a compound of interest in both industrial and research settings.
Formula:C2H4O8S2
InChI:InChI=1/C2H6O8S2/c3-1(11(5,6)7)2(4)12(8,9)10/h1-4H,(H,5,6,7)(H,8,9,10)/p-2/t1-,2-/m1/s1
SMILES:[C@@H]([C@H](O)S(=O)(=O)[O-])(O)S(=O)(=O)[O-]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Glyoxal Sodium Bisulfite Hydrate (contains oligomers)
CAS:Formula:C2H2O2·2NaHSO3·xH2OPurity:>90.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:266.15 (as Anhydrous)GLYOXAL SODIUM BISULFITE ADDITION COMPOUND HYDRATE, 98
CAS:Formula:C2H6Na2O9S2Purity:97%Color and Shape:SolidMolecular weight:284.1732glyoxal Sodium Bisulfite Hydrate (contains oligomers)
CAS:glyoxal Sodium Bisulfite Hydrate (contains oligomers)Purity:>90.0%Glyoxal sodium bisulfite addition compound hydrate
CAS:Formula:C2H6Na2O9S2Purity:97.0%Color and Shape:Solid, CrystallineMolecular weight:284.16




