CymitQuimica logo

CAS 33240-56-1

:

1-Chloro-5-methylhexane

Description:
1-Chloro-5-methylhexane is an organic compound classified as a haloalkane, specifically a chlorinated hydrocarbon. It features a six-carbon chain with a chlorine atom attached to the first carbon and a methyl group on the fifth carbon, giving it a branched structure. This compound is typically a colorless liquid at room temperature and is characterized by its moderate volatility and solubility in organic solvents, while being less soluble in water due to its hydrophobic nature. The presence of the chlorine atom introduces polar characteristics, which can influence its reactivity and interactions with other substances. 1-Chloro-5-methylhexane can participate in nucleophilic substitution reactions, making it useful in organic synthesis. Its physical properties, such as boiling point and density, are influenced by the molecular structure and the presence of the chlorine atom. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks if inhaled or ingested.
Formula:C7H15Cl
InChI:InChI=1S/C7H15Cl/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3
InChI key:InChIKey=YESHSLGUAPTMLI-UHFFFAOYSA-N
SMILES:C(CCCCl)C(C)C
Synonyms:
  • 1-Chloro-5-methylhexane
  • Hexane, 1-chloro-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.