CAS 33244-00-7: N'-phenylbenzenecarbohydrazonamide hydrochloride (1:1)

Description:N'-phenylbenzenecarbohydrazonamide hydrochloride is a chemical compound characterized by its hydrazone functional group, which is formed from the reaction of a hydrazine derivative with a carbonyl compound. This substance typically appears as a crystalline solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. Its molecular structure includes a phenyl group, which contributes to its aromatic properties, and a hydrazone linkage that may exhibit biological activity. The compound is often studied for its potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents. As with many hydrazone derivatives, it may also exhibit tautomeric behavior, which can influence its reactivity and stability. Safety data should be consulted for handling and usage, as hydrazone compounds can sometimes pose health risks. Overall, N'-phenylbenzenecarbohydrazonamide hydrochloride represents a class of compounds with diverse chemical properties and potential applications in medicinal chemistry.

Formula:C₁₃H₁₄ClN₃

InChI:InChI=1/C13H13N3.ClH/c14-13(11-7-3-1-4-8-11)16-15-12-9-5-2-6-10-12;/h1-10,15H,(H2,14,16);1H